C26H27F3O3S — CID 70153031
(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethylsulfonyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene (PubChem CID 70153031) has the molecular formula C26H27F3O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethylsulfonyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethylsulfonyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70153031 |
| Molecular Formula | C26H27F3O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethylsulfonyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC=C2S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C26H27F3O3S/c1-25-14-13-21-20-10-8-19(32-16-17-5-3-2-4-6-17)15-18(20)7-9-22(21)23(25)11-12-24(25)33(30,31)26(27,28)29/h2-6,8,10,12,15,21-23H,7,9,11,13-14,16H2,1H3/t21-,22-,23+,25+/m1/s1 |
| InChIKey | JUUHOMPSAQESPW-AHCIIZGASA-N |
| XLogP | 6.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |