About (2S,3S)-1,4-dichlorobutane-2,3-diol
(2S,3S)-1,4-dichlorobutane-2,3-diol (PubChem CID 7015309) has the molecular formula C4H8Cl2O2
and a molecular weight of 159.01 g/mol. Its IUPAC name is (2S,3S)-1,4-dichlorobutane-2,3-diol.
Molecular Properties
| Compound Name | (2S,3S)-1,4-dichlorobutane-2,3-diol |
| PubChem CID | 7015309 |
| Molecular Formula | C4H8Cl2O2 |
| Molecular Weight | 159.01 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | (2S,3S)-1,4-dichlorobutane-2,3-diol |
| SMILES | O[C@H](CCl)[C@H](O)CCl |
| InChI | InChI=1S/C4H8Cl2O2/c5-1-3(7)4(8)2-6/h3-4,7-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | SAUBRJOIKMVSRU-QWWZWVQMSA-N |
| XLogP | 0.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.01 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-1,4-dichlorobutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-1,4-dichlorobutane-2,3-diol?
The IUPAC name of (2S,3S)-1,4-dichlorobutane-2,3-diol (CID 7015309) is (2S,3S)-1,4-dichlorobutane-2,3-diol.
What is the SMILES notation for (2S,3S)-1,4-dichlorobutane-2,3-diol?
The canonical SMILES for (2S,3S)-1,4-dichlorobutane-2,3-diol is O[C@H](CCl)[C@H](O)CCl.
What is the InChIKey of (2S,3S)-1,4-dichlorobutane-2,3-diol?
The InChIKey is SAUBRJOIKMVSRU-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H8Cl2O2/c5-1-3(7)4(8)2-6/h3-4,7-8H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (2S,3S)-1,4-dichlorobutane-2,3-diol?
(2S,3S)-1,4-dichlorobutane-2,3-diol has a molecular weight of 159.01 g/mol, XLogP of 0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-1,4-dichlorobutane-2,3-diol is sourced from PubChem (CID 7015309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).