About 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene
1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene (PubChem CID 7015317) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene |
| PubChem CID | 7015317 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene |
| SMILES | CCOC(CSc1ccc(C)cc1)OCC |
| InChI | InChI=1S/C13H20O2S/c1-4-14-13(15-5-2)10-16-12-8-6-11(3)7-9-12/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | CZOGWUVOCUTQOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene?
The IUPAC name of 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene (CID 7015317) is 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene.
What is the SMILES notation for 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene?
The canonical SMILES for 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene is CCOC(CSc1ccc(C)cc1)OCC.
What is the InChIKey of 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene?
The InChIKey is CZOGWUVOCUTQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-4-14-13(15-5-2)10-16-12-8-6-11(3)7-9-12/h6-9,13H,4-5,10H2,1-3H3.
What are the key properties of 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene?
1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene has a molecular weight of 240.37 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethylsulfanyl)-4-methylbenzene is sourced from PubChem (CID 7015317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).