About pyrrolo[2,3-e]indole-2-carboxamide
pyrrolo[2,3-e]indole-2-carboxamide (PubChem CID 70153184) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is pyrrolo[2,3-e]indole-2-carboxamide.
Molecular Properties
| Compound Name | pyrrolo[2,3-e]indole-2-carboxamide |
| PubChem CID | 70153184 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | pyrrolo[2,3-e]indole-2-carboxamide |
| SMILES | NC(=O)C1=Nc2c3c(ccc2=C1)=NC=C3 |
| InChI | InChI=1S/C11H7N3O/c12-11(15)9-5-6-1-2-8-7(3-4-13-8)10(6)14-9/h1-5H,(H2,12,15) |
| InChIKey | CQZVSBFXOTZJBC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[2,3-e]indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-e]indole-2-carboxamide?
The IUPAC name of pyrrolo[2,3-e]indole-2-carboxamide (CID 70153184) is pyrrolo[2,3-e]indole-2-carboxamide.
What is the SMILES notation for pyrrolo[2,3-e]indole-2-carboxamide?
The canonical SMILES for pyrrolo[2,3-e]indole-2-carboxamide is NC(=O)C1=Nc2c3c(ccc2=C1)=NC=C3.
What is the InChIKey of pyrrolo[2,3-e]indole-2-carboxamide?
The InChIKey is CQZVSBFXOTZJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c12-11(15)9-5-6-1-2-8-7(3-4-13-8)10(6)14-9/h1-5H,(H2,12,15).
What are the key properties of pyrrolo[2,3-e]indole-2-carboxamide?
pyrrolo[2,3-e]indole-2-carboxamide has a molecular weight of 197.20 g/mol, XLogP of -0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-e]indole-2-carboxamide is sourced from PubChem (CID 70153184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).