C19H24Cl2F3N3O4 — CID 70153654
(2R)-1-[(2S)-2-aminobutanoyl]-N-butyl-4,5-dichloro-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 70153654) has the molecular formula C19H24Cl2F3N3O4 and a molecular weight of 486.32 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-aminobutanoyl]-N-butyl-4,5-dichloro-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-1-[(2S)-2-aminobutanoyl]-N-butyl-4,5-dichloro-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70153654 |
| Molecular Formula | C19H24Cl2F3N3O4 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (2R)-1-[(2S)-2-aminobutanoyl]-N-butyl-4,5-dichloro-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)[C@H]1Cc2c(ccc(Cl)c2Cl)N1C(=O)[C@@H](N)CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23Cl2N3O2.C2HF3O2/c1-3-5-8-21-16(23)14-9-10-13(7-6-11(18)15(10)19)22(14)17(24)12(20)4-2;3-2(4,5)1(6)7/h6-7,12,14H,3-5,8-9,20H2,1-2H3,(H,21,23);(H,6,7)/t12-,14+;/m0./s1 |
| InChIKey | WABXALRMIMUCRU-DSHXVJGRSA-N |
| XLogP | 3.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|