About 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine
3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine (PubChem CID 70153753) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine.
Molecular Properties
| Compound Name | 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine |
| PubChem CID | 70153753 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C(C2=C/C(=N/[H])C=CC2)C1 |
| InChI | InChI=1S/C12H12N2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-3,5-6,8,13-14H,4,7H2/b13-11+,14-12+ |
| InChIKey | QRINROVRMDFBFV-PHEQNACWSA-N |
| XLogP | 2.80 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine?
The IUPAC name of 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine (CID 70153753) is 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine.
What is the SMILES notation for 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine?
The canonical SMILES for 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine is [H]/N=C1\C=CC=C(C2=C/C(=N/[H])C=CC2)C1.
What is the InChIKey of 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine?
The InChIKey is QRINROVRMDFBFV-PHEQNACWSA-N. The full InChI is InChI=1S/C12H12N2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-3,5-6,8,13-14H,4,7H2/b13-11+,14-12+.
What are the key properties of 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine?
3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine has a molecular weight of 184.24 g/mol, XLogP of 2.80, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-iminocyclohexa-1,3-dien-1-yl)cyclohexa-2,5-dien-1-imine is sourced from PubChem (CID 70153753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).