C31H38N6O4S — CID 70154059
3-(benzenesulfonamido)-3-[benzyl-[[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)piperazin-1-yl]phenyl]methyl]amino]propanoic acid (PubChem CID 70154059) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-3-[benzyl-[[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)piperazin-1-yl]phenyl]methyl]amino]propanoic acid.
| Compound Name | 3-(benzenesulfonamido)-3-[benzyl-[[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)piperazin-1-yl]phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70154059 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 3-(benzenesulfonamido)-3-[benzyl-[[4-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)piperazin-1-yl]phenyl]methyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1ccccc1)N(Cc1ccccc1)Cc1ccc(N2CCN(C3=NCCCN3)CC2)cc1 |
| InChI | InChI=1S/C31H38N6O4S/c38-30(39)22-29(34-42(40,41)28-10-5-2-6-11-28)37(23-25-8-3-1-4-9-25)24-26-12-14-27(15-13-26)35-18-20-36(21-19-35)31-32-16-7-17-33-31/h1-6,8-15,29,34H,7,16-24H2,(H,32,33)(H,38,39) |
| InChIKey | PGADCOFSHDDFIB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|