C26H26N6O3 — CID 70154720
[2-[1-(4-aminobutyl)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate (PubChem CID 70154720) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is [2-[1-(4-aminobutyl)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate.
| Compound Name | [2-[1-(4-aminobutyl)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate |
|---|---|
| PubChem CID | 70154720 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [2-[1-(4-aminobutyl)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate |
| SMILES | CC(=O)On1c(=O)c(-c2cn(CCCCN)c3ccccc23)nc2cc3nc(C)c(C)nc3cc21 |
| InChI | InChI=1S/C26H26N6O3/c1-15-16(2)29-21-13-24-22(12-20(21)28-15)30-25(26(34)32(24)35-17(3)33)19-14-31(11-7-6-10-27)23-9-5-4-8-18(19)23/h4-5,8-9,12-14H,6-7,10-11,27H2,1-3H3 |
| InChIKey | HWKOSYUPRXTRAW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|