About 2-methylprop-2-enoic acid;2-prop-2-enylphenol
2-methylprop-2-enoic acid;2-prop-2-enylphenol (PubChem CID 70155060) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;2-prop-2-enylphenol |
| PubChem CID | 70155060 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-methylprop-2-enoic acid;2-prop-2-enylphenol |
| SMILES | C=C(C)C(=O)O.C=CCc1ccccc1O |
| InChI | InChI=1S/C9H10O.C4H6O2/c1-2-5-8-6-3-4-7-9(8)10;1-3(2)4(5)6/h2-4,6-7,10H,1,5H2;1H2,2H3,(H,5,6) |
| InChIKey | YRXWOZVAEYPTDG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;2-prop-2-enylphenol?
The IUPAC name of 2-methylprop-2-enoic acid;2-prop-2-enylphenol (CID 70155060) is 2-methylprop-2-enoic acid;2-prop-2-enylphenol.
What is the SMILES notation for 2-methylprop-2-enoic acid;2-prop-2-enylphenol?
The canonical SMILES for 2-methylprop-2-enoic acid;2-prop-2-enylphenol is C=C(C)C(=O)O.C=CCc1ccccc1O.
What is the InChIKey of 2-methylprop-2-enoic acid;2-prop-2-enylphenol?
The InChIKey is YRXWOZVAEYPTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C4H6O2/c1-2-5-8-6-3-4-7-9(8)10;1-3(2)4(5)6/h2-4,6-7,10H,1,5H2;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;2-prop-2-enylphenol?
2-methylprop-2-enoic acid;2-prop-2-enylphenol has a molecular weight of 220.27 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;2-prop-2-enylphenol is sourced from PubChem (CID 70155060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).