C24H27N3O5S — CID 70155904
but-2-enedioic acid;12-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-b][1,5]benzoxazepine (PubChem CID 70155904) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is but-2-enedioic acid;12-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-b][1,5]benzoxazepine.
| Compound Name | but-2-enedioic acid;12-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-b][1,5]benzoxazepine |
|---|---|
| PubChem CID | 70155904 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | but-2-enedioic acid;12-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydro-[1]benzothiolo[2,3-b][1,5]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3sc4c(c32)CCCC4)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H23N3OS.C4H4O4/c1-22-10-12-23(13-11-22)19-18-14-6-2-5-9-17(14)25-20(18)24-16-8-4-3-7-15(16)21-19;5-3(6)1-2-4(7)8/h3-4,7-8H,2,5-6,9-13H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | WKENCUDUTKCAEX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|