C22H28N2O4 — CID 70155955
1-(3-methylbut-2-enyl)-3-(3-methylbutyl)-5-(2-phenylacetyl)-1,3-diazinane-2,4,6-trione (PubChem CID 70155955) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-3-(3-methylbutyl)-5-(2-phenylacetyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-methylbut-2-enyl)-3-(3-methylbutyl)-5-(2-phenylacetyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70155955 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-3-(3-methylbutyl)-5-(2-phenylacetyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)=CCN1C(=O)C(C(=O)Cc2ccccc2)C(=O)N(CCC(C)C)C1=O |
| InChI | InChI=1S/C22H28N2O4/c1-15(2)10-12-23-20(26)19(18(25)14-17-8-6-5-7-9-17)21(27)24(22(23)28)13-11-16(3)4/h5-10,16,19H,11-14H2,1-4H3 |
| InChIKey | SVAJOXORKZQMDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|