About (4S)-4-ethyl-1,3-dioxolan-2-one
(4S)-4-ethyl-1,3-dioxolan-2-one (PubChem CID 7015599) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is (4S)-4-ethyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | (4S)-4-ethyl-1,3-dioxolan-2-one |
| PubChem CID | 7015599 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (4S)-4-ethyl-1,3-dioxolan-2-one |
| SMILES | CC[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C5H8O3/c1-2-4-3-7-5(6)8-4/h4H,2-3H2,1H3/t4-/m0/s1 |
| InChIKey | ZZXUZKXVROWEIF-BYPYZUCNSA-N |
| XLogP | 0.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-ethyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-ethyl-1,3-dioxolan-2-one?
The IUPAC name of (4S)-4-ethyl-1,3-dioxolan-2-one (CID 7015599) is (4S)-4-ethyl-1,3-dioxolan-2-one.
What is the SMILES notation for (4S)-4-ethyl-1,3-dioxolan-2-one?
The canonical SMILES for (4S)-4-ethyl-1,3-dioxolan-2-one is CC[C@H]1COC(=O)O1.
What is the InChIKey of (4S)-4-ethyl-1,3-dioxolan-2-one?
The InChIKey is ZZXUZKXVROWEIF-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-4-3-7-5(6)8-4/h4H,2-3H2,1H3/t4-/m0/s1.
What are the key properties of (4S)-4-ethyl-1,3-dioxolan-2-one?
(4S)-4-ethyl-1,3-dioxolan-2-one has a molecular weight of 116.12 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-ethyl-1,3-dioxolan-2-one is sourced from PubChem (CID 7015599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).