C30H31F5N6O4 — CID 70156617
4-[1-[(1S,3R)-3-[(dimethylamino)methyl]cyclopentyl]-5-fluoroindol-3-yl]-5-(5-fluoro-1-methylindol-3-yl)-2-(hydroxymethyl)-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid (PubChem CID 70156617) has the molecular formula C30H31F5N6O4 and a molecular weight of 634.61 g/mol. Its IUPAC name is 4-[1-[(1S,3R)-3-[(dimethylamino)methyl]cyclopentyl]-5-fluoroindol-3-yl]-5-(5-fluoro-1-methylindol-3-yl)-2-(hydroxymethyl)-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[1-[(1S,3R)-3-[(dimethylamino)methyl]cyclopentyl]-5-fluoroindol-3-yl]-5-(5-fluoro-1-methylindol-3-yl)-2-(hydroxymethyl)-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70156617 |
| Molecular Formula | C30H31F5N6O4 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 4-[1-[(1S,3R)-3-[(dimethylamino)methyl]cyclopentyl]-5-fluoroindol-3-yl]-5-(5-fluoro-1-methylindol-3-yl)-2-(hydroxymethyl)-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C[C@@H]1CC[C@H](n2cc(-n3c(-c4cn(C)c5ccc(F)cc45)nn(CO)c3=O)c3cc(F)ccc32)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H30F2N6O2.C2HF3O2/c1-32(2)13-17-4-7-20(10-17)34-15-26(22-12-19(30)6-9-25(22)34)36-27(31-35(16-37)28(36)38)23-14-33(3)24-8-5-18(29)11-21(23)24;3-2(4,5)1(6)7/h5-6,8-9,11-12,14-15,17,20,37H,4,7,10,13,16H2,1-3H3;(H,6,7)/t17-,20+;/m1./s1 |
| InChIKey | JCBGOGOMFOAFLR-XLCHORMMSA-N |
| XLogP | 4.91 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |