C33H34N4O3 — CID 70157184
[2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3-oxo-6,7,8,9-tetrahydrobenzo[g]quinoxalin-4-yl] acetate (PubChem CID 70157184) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is [2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3-oxo-6,7,8,9-tetrahydrobenzo[g]quinoxalin-4-yl] acetate.
| Compound Name | [2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3-oxo-6,7,8,9-tetrahydrobenzo[g]quinoxalin-4-yl] acetate |
|---|---|
| PubChem CID | 70157184 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3-oxo-6,7,8,9-tetrahydrobenzo[g]quinoxalin-4-yl] acetate |
| SMILES | CC(=O)On1c(=O)c(-c2c(Cc3ccccc3)n(CCCCN)c3ccccc23)nc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C33H34N4O3/c1-22(38)40-37-29-21-25-14-6-5-13-24(25)20-27(29)35-32(33(37)39)31-26-15-7-8-16-28(26)36(18-10-9-17-34)30(31)19-23-11-3-2-4-12-23/h2-4,7-8,11-12,15-16,20-21H,5-6,9-10,13-14,17-19,34H2,1H3 |
| InChIKey | QPHHGPJHYASWDC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|