C9H10ClF3N4O2S — CID 70157254
1-N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine (PubChem CID 70157254) has the molecular formula C9H10ClF3N4O2S and a molecular weight of 330.72 g/mol. Its IUPAC name is 1-N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine.
| Compound Name | 1-N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 70157254 |
| Molecular Formula | C9H10ClF3N4O2S |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1-N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
| SMILES | CNC(=C[N+](=O)[O-])N(Cc1cnc(Cl)s1)CC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N4O2S/c1-14-7(4-17(18)19)16(5-9(11,12)13)3-6-2-15-8(10)20-6/h2,4,14H,3,5H2,1H3 |
| InChIKey | BBEVGWDJXNPQAB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|