C37H64O10Si — CID 70157491
methyl (Z)-9-[(1R,2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate (PubChem CID 70157491) has the molecular formula C37H64O10Si and a molecular weight of 696.99 g/mol. Its IUPAC name is methyl (Z)-9-[(1R,2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate.
| Compound Name | methyl (Z)-9-[(1R,2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate |
|---|---|
| PubChem CID | 70157491 |
| Molecular Formula | C37H64O10Si |
| Molecular Weight | 696.99 g/mol |
| Exact Mass | 696.43 |
| IUPAC Name | methyl (Z)-9-[(1R,2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate |
| SMILES | COC(=O)C(OC1CCCCO1)C(=O)CCC/C=C\C[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C37H64O10Si/c1-37(2,3)48(5,6)44-26-28-27(30(45-32-19-11-14-22-41-32)25-31(28)46-33-20-12-15-23-42-33)17-9-7-8-10-18-29(38)35(36(39)40-4)47-34-21-13-16-24-43-34/h7,9,27-28,30-35H,8,10-26H2,1-6H3/b9-7-/t27-,28-,30-,31-,32?,33?,34?,35?/m1/s1 |
| InChIKey | SWPHPGCCJUXFIO-DUVNFYRYSA-N |
| XLogP | 7.24 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.99 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|