C26H32N4O4 — CID 70158000
2-[1-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]oxyacetic acid (PubChem CID 70158000) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[1-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 70158000 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[1-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]oxyacetic acid |
| SMILES | N/C(=N\CCc1ccccc1)c1ccc(C2=NOC(CN3CCC(OCC(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C26H32N4O4/c27-26(28-13-10-19-4-2-1-3-5-19)21-8-6-20(7-9-21)24-16-23(34-29-24)17-30-14-11-22(12-15-30)33-18-25(31)32/h1-9,22-23H,10-18H2,(H2,27,28)(H,31,32) |
| InChIKey | XQHFDELOOSOBDH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|