About thiophene;thiophene-2-carboximidamide
thiophene;thiophene-2-carboximidamide (PubChem CID 70158674) has the molecular formula C9H10N2S2
and a molecular weight of 210.33 g/mol. Its IUPAC name is thiophene;thiophene-2-carboximidamide.
Molecular Properties
| Compound Name | thiophene;thiophene-2-carboximidamide |
| PubChem CID | 70158674 |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | thiophene;thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccs1.c1ccsc1 |
| InChI | InChI=1S/C5H6N2S.C4H4S/c6-5(7)4-2-1-3-8-4;1-2-4-5-3-1/h1-3H,(H3,6,7);1-4H |
| InChIKey | UJFMVQDRWJFEDV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze thiophene;thiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene;thiophene-2-carboximidamide?
The IUPAC name of thiophene;thiophene-2-carboximidamide (CID 70158674) is thiophene;thiophene-2-carboximidamide.
What is the SMILES notation for thiophene;thiophene-2-carboximidamide?
The canonical SMILES for thiophene;thiophene-2-carboximidamide is [H]/N=C(\N)c1cccs1.c1ccsc1.
What is the InChIKey of thiophene;thiophene-2-carboximidamide?
The InChIKey is UJFMVQDRWJFEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2S.C4H4S/c6-5(7)4-2-1-3-8-4;1-2-4-5-3-1/h1-3H,(H3,6,7);1-4H.
What are the key properties of thiophene;thiophene-2-carboximidamide?
thiophene;thiophene-2-carboximidamide has a molecular weight of 210.33 g/mol, XLogP of 2.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene;thiophene-2-carboximidamide is sourced from PubChem (CID 70158674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).