About 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one
2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one (PubChem CID 70158942) has the molecular formula C10H11FO
and a molecular weight of 166.20 g/mol. Its IUPAC name is 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one |
| PubChem CID | 70158942 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one |
| SMILES | O=C1C2=C(C=CC1F)CCCC2 |
| InChI | InChI=1S/C10H11FO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h5-6,9H,1-4H2 |
| InChIKey | GDPVKSCGJNZFPJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one?
The IUPAC name of 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one (CID 70158942) is 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one.
What is the SMILES notation for 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one?
The canonical SMILES for 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one is O=C1C2=C(C=CC1F)CCCC2.
What is the InChIKey of 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one?
The InChIKey is GDPVKSCGJNZFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h5-6,9H,1-4H2.
What are the key properties of 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one?
2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one has a molecular weight of 166.20 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5,6,7,8-tetrahydro-2H-naphthalen-1-one is sourced from PubChem (CID 70158942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).