About 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride
2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride (PubChem CID 70159055) has the molecular formula C17H26ClN3O3
and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride.
Molecular Properties
| Compound Name | 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride |
| PubChem CID | 70159055 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride |
| SMILES | CN1CC[N+](C)(CCOC2=COC(c3ccccc3N)O2)CC1.[Cl-] |
| InChI | InChI=1S/C17H26N3O3.ClH/c1-19-7-9-20(2,10-8-19)11-12-21-16-13-22-17(23-16)14-5-3-4-6-15(14)18;/h3-6,13,17H,7-12,18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | RMERIAHYTHCDLI-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride?
The IUPAC name of 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride (CID 70159055) is 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride.
What is the SMILES notation for 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride?
The canonical SMILES for 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride is CN1CC[N+](C)(CCOC2=COC(c3ccccc3N)O2)CC1.[Cl-].
What is the InChIKey of 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride?
The InChIKey is RMERIAHYTHCDLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H26N3O3.ClH/c1-19-7-9-20(2,10-8-19)11-12-21-16-13-22-17(23-16)14-5-3-4-6-15(14)18;/h3-6,13,17H,7-12,18H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride?
2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride has a molecular weight of 355.87 g/mol, XLogP of -1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(1,4-dimethylpiperazin-1-ium-1-yl)ethoxy]-1,3-dioxol-2-yl]aniline chloride is sourced from PubChem (CID 70159055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).