C10H16N2O — CID 70159085
2-amino-1-(5-ethyl-1,2,3,6-tetrahydropyridin-6-yl)prop-2-en-1-one (PubChem CID 70159085) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-amino-1-(5-ethyl-1,2,3,6-tetrahydropyridin-6-yl)prop-2-en-1-one.
| Compound Name | 2-amino-1-(5-ethyl-1,2,3,6-tetrahydropyridin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70159085 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-amino-1-(5-ethyl-1,2,3,6-tetrahydropyridin-6-yl)prop-2-en-1-one |
| SMILES | C=C(N)C(=O)C1NCCC=C1CC |
| InChI | InChI=1S/C10H16N2O/c1-3-8-5-4-6-12-9(8)10(13)7(2)11/h5,9,12H,2-4,6,11H2,1H3 |
| InChIKey | HCFCKYYPHWLHNP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|