About 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid
2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid (PubChem CID 70159593) has the molecular formula C7H4FNO2S
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid |
| PubChem CID | 70159593 |
| Molecular Formula | C7H4FNO2S |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1c(F)sc2cc[nH]c12 |
| InChI | InChI=1S/C7H4FNO2S/c8-6-4(7(10)11)5-3(12-6)1-2-9-5/h1-2,9H,(H,10,11) |
| InChIKey | ROCFYXSLXQUGGP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid?
The IUPAC name of 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid (CID 70159593) is 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid.
What is the SMILES notation for 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid?
The canonical SMILES for 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid is O=C(O)c1c(F)sc2cc[nH]c12.
What is the InChIKey of 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid?
The InChIKey is ROCFYXSLXQUGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO2S/c8-6-4(7(10)11)5-3(12-6)1-2-9-5/h1-2,9H,(H,10,11).
What are the key properties of 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid?
2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid has a molecular weight of 185.18 g/mol, XLogP of 2.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4H-thieno[3,2-b]pyrrole-3-carboxylic acid is sourced from PubChem (CID 70159593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).