About azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole
azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole (PubChem CID 70160075) has the molecular formula C15H21ClN2O4
and a molecular weight of 328.80 g/mol. Its IUPAC name is azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole |
| PubChem CID | 70160075 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole |
| SMILES | CCCN1CCc2ccc(Cl)cc21.N.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H14ClN.C4H4O4.H3N/c1-2-6-13-7-5-9-3-4-10(12)8-11(9)13;5-3(6)1-2-4(7)8;/h3-4,8H,2,5-7H2,1H3;1-2H,(H,5,6)(H,7,8);1H3 |
| InChIKey | DIGLPTFPCQSOLS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole?
The IUPAC name of azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole (CID 70160075) is azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole.
What is the SMILES notation for azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole?
The canonical SMILES for azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole is CCCN1CCc2ccc(Cl)cc21.N.O=C(O)C=CC(=O)O.
What is the InChIKey of azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole?
The InChIKey is DIGLPTFPCQSOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN.C4H4O4.H3N/c1-2-6-13-7-5-9-3-4-10(12)8-11(9)13;5-3(6)1-2-4(7)8;/h3-4,8H,2,5-7H2,1H3;1-2H,(H,5,6)(H,7,8);1H3.
What are the key properties of azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole?
azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole has a molecular weight of 328.80 g/mol, XLogP of 2.99, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;but-2-enedioic acid;6-chloro-1-propyl-2,3-dihydroindole is sourced from PubChem (CID 70160075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).