C24H32BrNO5 — CID 70160311
(2E,6E)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dien-1-ol;(E)-but-2-enedioic acid (PubChem CID 70160311) has the molecular formula C24H32BrNO5 and a molecular weight of 494.43 g/mol. Its IUPAC name is (2E,6E)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dien-1-ol;(E)-but-2-enedioic acid.
| Compound Name | (2E,6E)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dien-1-ol;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70160311 |
| Molecular Formula | C24H32BrNO5 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | (2E,6E)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dien-1-ol;(E)-but-2-enedioic acid |
| SMILES | C=CCN(C)C/C=C(\C)CC/C=C(\C)C(O)c1ccc(Br)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H28BrNO.C4H4O4/c1-5-14-22(4)15-13-16(2)7-6-8-17(3)20(23)18-9-11-19(21)12-10-18;5-3(6)1-2-4(7)8/h5,8-13,20,23H,1,6-7,14-15H2,2-4H3;1-2H,(H,5,6)(H,7,8)/b16-13+,17-8+;2-1+ |
| InChIKey | KZNWQGBMIAUPPN-CFEZTNSMSA-N |
| XLogP | 4.98 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|