C46H37F2N5O2S — CID 70160378
2-[4,4-difluoro-1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2,3-dihydro-1-benzazepin-5-ylidene]-N-[(1-tritylimidazol-4-yl)methyl]acetamide (PubChem CID 70160378) has the molecular formula C46H37F2N5O2S and a molecular weight of 761.90 g/mol. Its IUPAC name is 2-[4,4-difluoro-1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2,3-dihydro-1-benzazepin-5-ylidene]-N-[(1-tritylimidazol-4-yl)methyl]acetamide.
| Compound Name | 2-[4,4-difluoro-1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2,3-dihydro-1-benzazepin-5-ylidene]-N-[(1-tritylimidazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 70160378 |
| Molecular Formula | C46H37F2N5O2S |
| Molecular Weight | 761.90 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | 2-[4,4-difluoro-1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)-2,3-dihydro-1-benzazepin-5-ylidene]-N-[(1-tritylimidazol-4-yl)methyl]acetamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)N1CCC(F)(F)C(=CC(=O)NCc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c2ccccc21 |
| InChI | InChI=1S/C46H37F2N5O2S/c1-32-42(56-43(51-32)33-16-6-2-7-17-33)44(55)53-27-26-45(47,48)39(38-24-14-15-25-40(38)53)28-41(54)49-29-37-30-52(31-50-37)46(34-18-8-3-9-19-34,35-20-10-4-11-21-35)36-22-12-5-13-23-36/h2-25,28,30-31H,26-27,29H2,1H3,(H,49,54) |
| InChIKey | IKUNTKMHDBYCRV-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.90 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|