C19H20N2O3 — CID 70160522
N-[(3,4-dihydroxyphenyl)methyl]-3-(1H-indol-3-yl)-2-methylpropanamide (PubChem CID 70160522) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-3-(1H-indol-3-yl)-2-methylpropanamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-3-(1H-indol-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 70160522 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-3-(1H-indol-3-yl)-2-methylpropanamide |
| SMILES | CC(Cc1c[nH]c2ccccc12)C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-12(8-14-11-20-16-5-3-2-4-15(14)16)19(24)21-10-13-6-7-17(22)18(23)9-13/h2-7,9,11-12,20,22-23H,8,10H2,1H3,(H,21,24) |
| InChIKey | USPQTYMBQHHTND-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|