About 4-methylaniline;N-methylthian-4-amine
4-methylaniline;N-methylthian-4-amine (PubChem CID 70160608) has the molecular formula C13H22N2S
and a molecular weight of 238.40 g/mol. Its IUPAC name is 4-methylaniline;N-methylthian-4-amine.
Molecular Properties
| Compound Name | 4-methylaniline;N-methylthian-4-amine |
| PubChem CID | 70160608 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-methylaniline;N-methylthian-4-amine |
| SMILES | CNC1CCSCC1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9N.C6H13NS/c1-6-2-4-7(8)5-3-6;1-7-6-2-4-8-5-3-6/h2-5H,8H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | BTSPHRXFVSXVIY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylaniline;N-methylthian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylaniline;N-methylthian-4-amine?
The IUPAC name of 4-methylaniline;N-methylthian-4-amine (CID 70160608) is 4-methylaniline;N-methylthian-4-amine.
What is the SMILES notation for 4-methylaniline;N-methylthian-4-amine?
The canonical SMILES for 4-methylaniline;N-methylthian-4-amine is CNC1CCSCC1.Cc1ccc(N)cc1.
What is the InChIKey of 4-methylaniline;N-methylthian-4-amine?
The InChIKey is BTSPHRXFVSXVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H13NS/c1-6-2-4-7(8)5-3-6;1-7-6-2-4-8-5-3-6/h2-5H,8H2,1H3;6-7H,2-5H2,1H3.
What are the key properties of 4-methylaniline;N-methylthian-4-amine?
4-methylaniline;N-methylthian-4-amine has a molecular weight of 238.40 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylaniline;N-methylthian-4-amine is sourced from PubChem (CID 70160608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).