C19H20O2 — CID 70160856
(3aS,5S,6aS)-5-methyl-3a-(naphthalen-2-ylmethyl)-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one (PubChem CID 70160856) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3aS,5S,6aS)-5-methyl-3a-(naphthalen-2-ylmethyl)-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one.
| Compound Name | (3aS,5S,6aS)-5-methyl-3a-(naphthalen-2-ylmethyl)-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 70160856 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3aS,5S,6aS)-5-methyl-3a-(naphthalen-2-ylmethyl)-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
| SMILES | C[C@H]1C[C@@H]2COC(=O)[C@]2(Cc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C19H20O2/c1-13-8-17-12-21-18(20)19(17,10-13)11-14-6-7-15-4-2-3-5-16(15)9-14/h2-7,9,13,17H,8,10-12H2,1H3/t13-,17+,19-/m0/s1 |
| InChIKey | JXAYQKXZVONDMT-IRWQIABSSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |