C17H37N2O3+ — CID 70161005
[2-hydroxy-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-dimethyl-propylazanium (PubChem CID 70161005) has the molecular formula C17H37N2O3+ and a molecular weight of 317.49 g/mol. Its IUPAC name is [2-hydroxy-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-dimethyl-propylazanium.
| Compound Name | [2-hydroxy-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-dimethyl-propylazanium |
|---|---|
| PubChem CID | 70161005 |
| Molecular Formula | C17H37N2O3+ |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | [2-hydroxy-3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)CC(O)COC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C17H37N2O3/c1-8-9-19(6,7)12-14(20)13-22-15-10-16(2,3)18(21)17(4,5)11-15/h14-15,20-21H,8-13H2,1-7H3/q+1 |
| InChIKey | WVTHZVYKCHMCRB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|