C21H24ClN3O3S — CID 70161074
N-[4-[2-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]phenyl]methanesulfonamide;hydrochloride (PubChem CID 70161074) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is N-[4-[2-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[4-[2-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 70161074 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-[2-[(3aR,9bS)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]phenyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(CCN2C[C@@H]3COc4ccc(C#N)cc4[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C21H23N3O3S.ClH/c1-28(25,26)23-18-5-2-15(3-6-18)8-9-24-12-17-14-27-21-7-4-16(11-22)10-19(21)20(17)13-24;/h2-7,10,17,20,23H,8-9,12-14H2,1H3;1H/t17-,20+;/m1./s1 |
| InChIKey | GOFOGAAPAACPTL-XLCHORMMSA-N |
| XLogP | 3.00 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |