C26H23N3O5 — CID 70161076
2-(2,7-dibenzyl-6-methyl-5-oxamoylpyrrolo[1,2-b]pyridazin-4-yl)oxyacetic acid (PubChem CID 70161076) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-(2,7-dibenzyl-6-methyl-5-oxamoylpyrrolo[1,2-b]pyridazin-4-yl)oxyacetic acid.
| Compound Name | 2-(2,7-dibenzyl-6-methyl-5-oxamoylpyrrolo[1,2-b]pyridazin-4-yl)oxyacetic acid |
|---|---|
| PubChem CID | 70161076 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-(2,7-dibenzyl-6-methyl-5-oxamoylpyrrolo[1,2-b]pyridazin-4-yl)oxyacetic acid |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)O)cc(Cc3ccccc3)nn2c1Cc1ccccc1 |
| InChI | InChI=1S/C26H23N3O5/c1-16-20(13-18-10-6-3-7-11-18)29-24(23(16)25(32)26(27)33)21(34-15-22(30)31)14-19(28-29)12-17-8-4-2-5-9-17/h2-11,14H,12-13,15H2,1H3,(H2,27,33)(H,30,31) |
| InChIKey | ZVKHJJOCTBHJIW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|