C10H19ClN2S — CID 70161194
3-(3-methylbut-2-enyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-amine;hydrochloride (PubChem CID 70161194) has the molecular formula C10H19ClN2S and a molecular weight of 234.80 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-amine;hydrochloride.
| Compound Name | 3-(3-methylbut-2-enyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-amine;hydrochloride |
|---|---|
| PubChem CID | 70161194 |
| Molecular Formula | C10H19ClN2S |
| Molecular Weight | 234.80 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-amine;hydrochloride |
| SMILES | CC(C)=CCC1CSCCC(N)=N1.Cl |
| InChI | InChI=1S/C10H18N2S.ClH/c1-8(2)3-4-9-7-13-6-5-10(11)12-9;/h3,9H,4-7H2,1-2H3,(H2,11,12);1H |
| InChIKey | BKPUQLRFDZFZOB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|