C20H28BrNO — CID 70161208
(E,2S)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]oct-6-en-1-one (PubChem CID 70161208) has the molecular formula C20H28BrNO and a molecular weight of 378.35 g/mol. Its IUPAC name is (E,2S)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]oct-6-en-1-one.
| Compound Name | (E,2S)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]oct-6-en-1-one |
|---|---|
| PubChem CID | 70161208 |
| Molecular Formula | C20H28BrNO |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (E,2S)-1-(4-bromophenyl)-2,6-dimethyl-8-[methyl(prop-2-enyl)amino]oct-6-en-1-one |
| SMILES | C=CCN(C)C/C=C(\C)CCC[C@H](C)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H28BrNO/c1-5-14-22(4)15-13-16(2)7-6-8-17(3)20(23)18-9-11-19(21)12-10-18/h5,9-13,17H,1,6-8,14-15H2,2-4H3/b16-13+/t17-/m0/s1 |
| InChIKey | JWJNGKVYGBDCJS-MAUBAPBLSA-N |
| XLogP | 5.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|