About 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid
4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 70162154) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid |
| PubChem CID | 70162154 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c20-15(16(21)18(23)24)17(22)19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15-16,20-21H,11-12H2,(H,23,24) |
| InChIKey | QHERASGNOTZQLN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid?
The IUPAC name of 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid (CID 70162154) is 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid.
What is the SMILES notation for 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid?
The canonical SMILES for 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid is O=C(O)C(O)C(O)C(=O)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid?
The InChIKey is QHERASGNOTZQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c20-15(16(21)18(23)24)17(22)19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15-16,20-21H,11-12H2,(H,23,24).
What are the key properties of 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid?
4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid has a molecular weight of 329.35 g/mol, XLogP of 1.02, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibenzylamino)-2,3-dihydroxy-4-oxobutanoic acid is sourced from PubChem (CID 70162154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).