C22H21FN2O2 — CID 70162171
4-[4-[(E)-4-(cyclopropylmethylamino)but-2-enoxy]-3-fluorobenzoyl]benzonitrile (PubChem CID 70162171) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[4-[(E)-4-(cyclopropylmethylamino)but-2-enoxy]-3-fluorobenzoyl]benzonitrile.
| Compound Name | 4-[4-[(E)-4-(cyclopropylmethylamino)but-2-enoxy]-3-fluorobenzoyl]benzonitrile |
|---|---|
| PubChem CID | 70162171 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[4-[(E)-4-(cyclopropylmethylamino)but-2-enoxy]-3-fluorobenzoyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)c2ccc(OC/C=C/CNCC3CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c23-20-13-19(22(26)18-7-5-16(14-24)6-8-18)9-10-21(20)27-12-2-1-11-25-15-17-3-4-17/h1-2,5-10,13,17,25H,3-4,11-12,15H2/b2-1+ |
| InChIKey | GCXORNOCWAHQAO-OWOJBTEDSA-N |
| XLogP | 3.86 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|