About 2,2-bis(prop-2-enyl)-1,3-thiazolidine
2,2-bis(prop-2-enyl)-1,3-thiazolidine (PubChem CID 70163327) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2,2-bis(prop-2-enyl)-1,3-thiazolidine |
| PubChem CID | 70163327 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2,2-bis(prop-2-enyl)-1,3-thiazolidine |
| SMILES | C=CCC1(CC=C)NCCS1 |
| InChI | InChI=1S/C9H15NS/c1-3-5-9(6-4-2)10-7-8-11-9/h3-4,10H,1-2,5-8H2 |
| InChIKey | ULFBCVQCXKSUCS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(prop-2-enyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(prop-2-enyl)-1,3-thiazolidine?
The IUPAC name of 2,2-bis(prop-2-enyl)-1,3-thiazolidine (CID 70163327) is 2,2-bis(prop-2-enyl)-1,3-thiazolidine.
What is the SMILES notation for 2,2-bis(prop-2-enyl)-1,3-thiazolidine?
The canonical SMILES for 2,2-bis(prop-2-enyl)-1,3-thiazolidine is C=CCC1(CC=C)NCCS1.
What is the InChIKey of 2,2-bis(prop-2-enyl)-1,3-thiazolidine?
The InChIKey is ULFBCVQCXKSUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-3-5-9(6-4-2)10-7-8-11-9/h3-4,10H,1-2,5-8H2.
What are the key properties of 2,2-bis(prop-2-enyl)-1,3-thiazolidine?
2,2-bis(prop-2-enyl)-1,3-thiazolidine has a molecular weight of 169.29 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enyl)-1,3-thiazolidine is sourced from PubChem (CID 70163327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).