C23H34N4O3 — CID 70163465
5-[(3aS,3bS,10S,11aS)-7-(methanehydrazonoylhydrazinylidene)-11a-methyl-2,3,3a,3b,4,5,8,9,10,11-decahydronaphtho[2,1-e][1]benzofuran-10-yl]pentanoic acid (PubChem CID 70163465) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 5-[(3aS,3bS,10S,11aS)-7-(methanehydrazonoylhydrazinylidene)-11a-methyl-2,3,3a,3b,4,5,8,9,10,11-decahydronaphtho[2,1-e][1]benzofuran-10-yl]pentanoic acid.
| Compound Name | 5-[(3aS,3bS,10S,11aS)-7-(methanehydrazonoylhydrazinylidene)-11a-methyl-2,3,3a,3b,4,5,8,9,10,11-decahydronaphtho[2,1-e][1]benzofuran-10-yl]pentanoic acid |
|---|---|
| PubChem CID | 70163465 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 5-[(3aS,3bS,10S,11aS)-7-(methanehydrazonoylhydrazinylidene)-11a-methyl-2,3,3a,3b,4,5,8,9,10,11-decahydronaphtho[2,1-e][1]benzofuran-10-yl]pentanoic acid |
| SMILES | C[C@]12C[C@H](CCCCC(=O)O)C3=C4CCC(=NNC=NN)C=C4CC[C@H]3[C@@H]1CCO2 |
| InChI | InChI=1S/C23H34N4O3/c1-23-13-16(4-2-3-5-21(28)29)22-18-9-7-17(27-26-14-25-24)12-15(18)6-8-19(22)20(23)10-11-30-23/h12,14,16,19-20H,2-11,13,24H2,1H3,(H,25,26)(H,28,29)/t16-,19-,20-,23-/m0/s1 |
| InChIKey | PCCZJRLVZCEPIP-ZPDADZDASA-N |
| XLogP | 3.72 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|