About 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile
3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile (PubChem CID 70163595) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile.
Molecular Properties
| Compound Name | 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile |
| PubChem CID | 70163595 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(-c2ccc([C@H]3C[C@@H]3N)cn2)c1 |
| InChI | InChI=1S/C16H15N3O/c1-20-13-5-10(8-17)4-12(6-13)16-3-2-11(9-19-16)14-7-15(14)18/h2-6,9,14-15H,7,18H2,1H3/t14-,15+/m1/s1 |
| InChIKey | QCSDZLQTWIZEDW-CABCVRRESA-N |
| XLogP | 2.44 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile?
The IUPAC name of 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile (CID 70163595) is 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile.
What is the SMILES notation for 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile?
The canonical SMILES for 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile is COc1cc(C#N)cc(-c2ccc([C@H]3C[C@@H]3N)cn2)c1.
What is the InChIKey of 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile?
The InChIKey is QCSDZLQTWIZEDW-CABCVRRESA-N. The full InChI is InChI=1S/C16H15N3O/c1-20-13-5-10(8-17)4-12(6-13)16-3-2-11(9-19-16)14-7-15(14)18/h2-6,9,14-15H,7,18H2,1H3/t14-,15+/m1/s1.
What are the key properties of 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile?
3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile has a molecular weight of 265.32 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]-5-methoxybenzonitrile is sourced from PubChem (CID 70163595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).