C34H35Cl3N6 — CID 70163649
2,3-bis[[4-(3-chlorophenyl)piperazin-1-yl]methyl]benzo[g]quinoxaline;hydrochloride (PubChem CID 70163649) has the molecular formula C34H35Cl3N6 and a molecular weight of 634.06 g/mol. Its IUPAC name is 2,3-bis[[4-(3-chlorophenyl)piperazin-1-yl]methyl]benzo[g]quinoxaline;hydrochloride.
| Compound Name | 2,3-bis[[4-(3-chlorophenyl)piperazin-1-yl]methyl]benzo[g]quinoxaline;hydrochloride |
|---|---|
| PubChem CID | 70163649 |
| Molecular Formula | C34H35Cl3N6 |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 2,3-bis[[4-(3-chlorophenyl)piperazin-1-yl]methyl]benzo[g]quinoxaline;hydrochloride |
| SMILES | Cl.Clc1cccc(N2CCN(Cc3nc4cc5ccccc5cc4nc3CN3CCN(c4cccc(Cl)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C34H34Cl2N6.ClH/c35-27-7-3-9-29(21-27)41-15-11-39(12-16-41)23-33-34(38-32-20-26-6-2-1-5-25(26)19-31(32)37-33)24-40-13-17-42(18-14-40)30-10-4-8-28(36)22-30;/h1-10,19-22H,11-18,23-24H2;1H |
| InChIKey | YWOUQOIHZLZICM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|