C32H38N8O6 — CID 70163661
2-[4-[(3-amino-2-pyridinyl)amino]phenyl]ethylcarbamic acid;tert-butyl N-[2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]ethyl]carbamate (PubChem CID 70163661) has the molecular formula C32H38N8O6 and a molecular weight of 630.71 g/mol. Its IUPAC name is 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]ethylcarbamic acid;tert-butyl N-[2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]ethyl]carbamate.
| Compound Name | 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]ethylcarbamic acid;tert-butyl N-[2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 70163661 |
| Molecular Formula | C32H38N8O6 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]ethylcarbamic acid;tert-butyl N-[2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(Nc2ncccc2[N+](=O)[O-])cc1.Nc1cccnc1Nc1ccc(CCNC(=O)O)cc1 |
| InChI | InChI=1S/C18H22N4O4.C14H16N4O2/c1-18(2,3)26-17(23)20-12-10-13-6-8-14(9-7-13)21-16-15(22(24)25)5-4-11-19-16;15-12-2-1-8-16-13(12)18-11-5-3-10(4-6-11)7-9-17-14(19)20/h4-9,11H,10,12H2,1-3H3,(H,19,21)(H,20,23);1-6,8,17H,7,9,15H2,(H,16,18)(H,19,20) |
| InChIKey | ZHBFKSUFJZWZGZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|