C16H15Cl2N3O4S — CID 70163723
(4E)-4-[chloro-[2-chloro-3-(4,5-dihydro-1,2-oxazol-3-yl)-4-methylsulfonylphenyl]methylidene]-2-ethylpyrazol-3-one (PubChem CID 70163723) has the molecular formula C16H15Cl2N3O4S and a molecular weight of 416.29 g/mol. Its IUPAC name is (4E)-4-[chloro-[2-chloro-3-(4,5-dihydro-1,2-oxazol-3-yl)-4-methylsulfonylphenyl]methylidene]-2-ethylpyrazol-3-one.
| Compound Name | (4E)-4-[chloro-[2-chloro-3-(4,5-dihydro-1,2-oxazol-3-yl)-4-methylsulfonylphenyl]methylidene]-2-ethylpyrazol-3-one |
|---|---|
| PubChem CID | 70163723 |
| Molecular Formula | C16H15Cl2N3O4S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | (4E)-4-[chloro-[2-chloro-3-(4,5-dihydro-1,2-oxazol-3-yl)-4-methylsulfonylphenyl]methylidene]-2-ethylpyrazol-3-one |
| SMILES | CCN1N=C/C(=C(\Cl)c2ccc(S(C)(=O)=O)c(C3=NOCC3)c2Cl)C1=O |
| InChI | InChI=1S/C16H15Cl2N3O4S/c1-3-21-16(22)10(8-19-21)14(17)9-4-5-12(26(2,23)24)13(15(9)18)11-6-7-25-20-11/h4-5,8H,3,6-7H2,1-2H3/b14-10+ |
| InChIKey | WRMVPIMUHHIHCO-GXDHUFHOSA-N |
| XLogP | 2.67 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|