About 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline
4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline (PubChem CID 70163885) has the molecular formula C27H25N3O
and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline.
Molecular Properties
| Compound Name | 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline |
| PubChem CID | 70163885 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline |
| SMILES | CCC1CN(c2ccccc2)C(c2c(OC)c(-c3ccccc3)nc3ccccc23)=N1 |
| InChI | InChI=1S/C27H25N3O/c1-3-20-18-30(21-14-8-5-9-15-21)27(28-20)24-22-16-10-11-17-23(22)29-25(26(24)31-2)19-12-6-4-7-13-19/h4-17,20H,3,18H2,1-2H3 |
| InChIKey | LCGNBGBIVQJXPG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline?
The IUPAC name of 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline (CID 70163885) is 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline.
What is the SMILES notation for 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline?
The canonical SMILES for 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline is CCC1CN(c2ccccc2)C(c2c(OC)c(-c3ccccc3)nc3ccccc23)=N1.
What is the InChIKey of 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline?
The InChIKey is LCGNBGBIVQJXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N3O/c1-3-20-18-30(21-14-8-5-9-15-21)27(28-20)24-22-16-10-11-17-23(22)29-25(26(24)31-2)19-12-6-4-7-13-19/h4-17,20H,3,18H2,1-2H3.
What are the key properties of 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline?
4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline has a molecular weight of 407.52 g/mol, XLogP of 5.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-1-phenyl-4,5-dihydroimidazol-2-yl)-3-methoxy-2-phenylquinoline is sourced from PubChem (CID 70163885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).