C13H30O2Si2 — CID 70164358
2,2,3,3,6-pentaethyloxadisilinan-6-ol (PubChem CID 70164358) has the molecular formula C13H30O2Si2 and a molecular weight of 274.55 g/mol. Its IUPAC name is 2,2,3,3,6-pentaethyloxadisilinan-6-ol.
| Compound Name | 2,2,3,3,6-pentaethyloxadisilinan-6-ol |
|---|---|
| PubChem CID | 70164358 |
| Molecular Formula | C13H30O2Si2 |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,2,3,3,6-pentaethyloxadisilinan-6-ol |
| SMILES | CCC1(O)CC[Si](CC)(CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C13H30O2Si2/c1-6-13(14)11-12-16(7-2,8-3)17(9-4,10-5)15-13/h14H,6-12H2,1-5H3 |
| InChIKey | QOECIJGERVQGTH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|