About 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline
5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline (PubChem CID 70164555) has the molecular formula C20H10Br2N2S2
and a molecular weight of 502.26 g/mol. Its IUPAC name is 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline.
Molecular Properties
| Compound Name | 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline |
| PubChem CID | 70164555 |
| Molecular Formula | C20H10Br2N2S2 |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 499.87 |
| IUPAC Name | 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline |
| SMILES | Brc1c2ccccc2c(Br)c2nc(-c3ccsc3)c(-c3ccsc3)nc12 |
| InChI | InChI=1S/C20H10Br2N2S2/c21-15-13-3-1-2-4-14(13)16(22)20-19(15)23-17(11-5-7-25-9-11)18(24-20)12-6-8-26-10-12/h1-10H |
| InChIKey | ATPLEUFIXKDYDC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline?
The IUPAC name of 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline (CID 70164555) is 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline.
What is the SMILES notation for 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline?
The canonical SMILES for 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline is Brc1c2ccccc2c(Br)c2nc(-c3ccsc3)c(-c3ccsc3)nc12.
What is the InChIKey of 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline?
The InChIKey is ATPLEUFIXKDYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Br2N2S2/c21-15-13-3-1-2-4-14(13)16(22)20-19(15)23-17(11-5-7-25-9-11)18(24-20)12-6-8-26-10-12/h1-10H.
What are the key properties of 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline?
5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline has a molecular weight of 502.26 g/mol, XLogP of 7.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dibromo-2,3-di(thiophen-3-yl)benzo[g]quinoxaline is sourced from PubChem (CID 70164555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).