About 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one
2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one (PubChem CID 70165154) has the molecular formula C13H10Cl2N4O
and a molecular weight of 309.16 g/mol. Its IUPAC name is 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one.
Molecular Properties
| Compound Name | 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one |
| PubChem CID | 70165154 |
| Molecular Formula | C13H10Cl2N4O |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one |
| SMILES | Cn1c2c(nc(-c3ccccc3Cl)c1=O)CN=C(Cl)N2 |
| InChI | InChI=1S/C13H10Cl2N4O/c1-19-11-9(6-16-13(15)18-11)17-10(12(19)20)7-4-2-3-5-8(7)14/h2-5H,6H2,1H3,(H,16,18) |
| InChIKey | NARWLTFBSUQEBI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one?
The IUPAC name of 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one (CID 70165154) is 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one.
What is the SMILES notation for 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one?
The canonical SMILES for 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one is Cn1c2c(nc(-c3ccccc3Cl)c1=O)CN=C(Cl)N2.
What is the InChIKey of 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one?
The InChIKey is NARWLTFBSUQEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N4O/c1-19-11-9(6-16-13(15)18-11)17-10(12(19)20)7-4-2-3-5-8(7)14/h2-5H,6H2,1H3,(H,16,18).
What are the key properties of 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one?
2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one has a molecular weight of 309.16 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(2-chlorophenyl)-8-methyl-1,4-dihydropteridin-7-one is sourced from PubChem (CID 70165154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).