C25H29N7O2 — CID 70165572
1-(carbamoylamino)-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-3-(2-piperidin-1-ylethyl)urea (PubChem CID 70165572) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-(carbamoylamino)-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-(carbamoylamino)-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 70165572 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-(carbamoylamino)-1-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-3-(2-piperidin-1-ylethyl)urea |
| SMILES | NC(=O)NN(C(=O)NCCN1CCCCC1)c1ccc(-c2n[nH]c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H29N7O2/c26-24(33)30-32(25(34)27-12-15-31-13-4-1-5-14-31)19-10-8-17(9-11-19)22-21-16-18-6-2-3-7-20(18)23(21)29-28-22/h2-3,6-11H,1,4-5,12-16H2,(H,27,34)(H,28,29)(H3,26,30,33) |
| InChIKey | KMSSJDZXNHFIIZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|