C18H23N3OS2 — CID 70165696
N'-[3-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-4-methylsulfanylphenyl]thiophene-2-carboximidamide (PubChem CID 70165696) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is N'-[3-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-4-methylsulfanylphenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-4-methylsulfanylphenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70165696 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N'-[3-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-4-methylsulfanylphenyl]thiophene-2-carboximidamide |
| SMILES | CSc1ccc(/N=C(\N)c2cccs2)cc1CN1CCC[C@@H]1CO |
| InChI | InChI=1S/C18H23N3OS2/c1-23-16-7-6-14(20-18(19)17-5-3-9-24-17)10-13(16)11-21-8-2-4-15(21)12-22/h3,5-7,9-10,15,22H,2,4,8,11-12H2,1H3,(H2,19,20)/t15-/m1/s1 |
| InChIKey | SFORIBZAPRLYSQ-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|