C31H31N7S2 — CID 70166220
N'-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]thiophene-2-carboximidamide;N'-[4-(imidazol-1-ylmethyl)phenyl]thiophene-2-carboximidamide (PubChem CID 70166220) has the molecular formula C31H31N7S2 and a molecular weight of 565.77 g/mol. Its IUPAC name is N'-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]thiophene-2-carboximidamide;N'-[4-(imidazol-1-ylmethyl)phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]thiophene-2-carboximidamide;N'-[4-(imidazol-1-ylmethyl)phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70166220 |
| Molecular Formula | C31H31N7S2 |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | N'-[4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]thiophene-2-carboximidamide;N'-[4-(imidazol-1-ylmethyl)phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(Cn2ccnc2)cc1)c1cccs1.N/C(=N\c1ccc(N2CC=CCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H17N3S.C15H14N4S/c17-16(15-5-4-12-20-15)18-13-6-8-14(9-7-13)19-10-2-1-3-11-19;16-15(14-2-1-9-20-14)18-13-5-3-12(4-6-13)10-19-8-7-17-11-19/h1-2,4-9,12H,3,10-11H2,(H2,17,18);1-9,11H,10H2,(H2,16,18) |
| InChIKey | QISKOZLKLZDDAR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|