C26H26F3NO2S — CID 70166391
2-phenyl-N-[[(1S,2R)-1-phenyl-6-(trifluoromethylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]ethanamine (PubChem CID 70166391) has the molecular formula C26H26F3NO2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-phenyl-N-[[(1S,2R)-1-phenyl-6-(trifluoromethylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]ethanamine.
| Compound Name | 2-phenyl-N-[[(1S,2R)-1-phenyl-6-(trifluoromethylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 70166391 |
| Molecular Formula | C26H26F3NO2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-phenyl-N-[[(1S,2R)-1-phenyl-6-(trifluoromethylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]ethanamine |
| SMILES | O=S(=O)(c1ccc2c(c1)CC[C@@H](CNCCc1ccccc1)[C@H]2c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F3NO2S/c27-26(28,29)33(31,32)23-13-14-24-21(17-23)11-12-22(25(24)20-9-5-2-6-10-20)18-30-16-15-19-7-3-1-4-8-19/h1-10,13-14,17,22,25,30H,11-12,15-16,18H2/t22-,25+/m0/s1 |
| InChIKey | FBQXYFXHIJESDK-WIOPSUGQSA-N |
| XLogP | 5.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|