C17H32N4 — CID 70166607
(2R)-6-(1,7-dimethyl-2,4,7,8-tetrahydropyrido[2,3-d]pyrimidin-3-yl)-N,N-dimethylhexan-2-amine (PubChem CID 70166607) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is (2R)-6-(1,7-dimethyl-2,4,7,8-tetrahydropyrido[2,3-d]pyrimidin-3-yl)-N,N-dimethylhexan-2-amine.
| Compound Name | (2R)-6-(1,7-dimethyl-2,4,7,8-tetrahydropyrido[2,3-d]pyrimidin-3-yl)-N,N-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 70166607 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | (2R)-6-(1,7-dimethyl-2,4,7,8-tetrahydropyrido[2,3-d]pyrimidin-3-yl)-N,N-dimethylhexan-2-amine |
| SMILES | CC1C=CC2=C(N1)N(C)CN(CCCC[C@@H](C)N(C)C)C2 |
| InChI | InChI=1S/C17H32N4/c1-14-9-10-16-12-21(13-20(5)17(16)18-14)11-7-6-8-15(2)19(3)4/h9-10,14-15,18H,6-8,11-13H2,1-5H3/t14?,15-/m1/s1 |
| InChIKey | SMSKOZMXRLKORH-YSSOQSIOSA-N |
| XLogP | 2.07 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|